CAS 1100767-08-5

4-Fluoro-2-pyridinebutanoic acid

Description:

4-Fluoro-2-pyridinebutanoic acid is a chemical compound characterized by its pyridine ring and a butanoic acid functional group. The presence of a fluorine atom at the 4-position of the pyridine ring influences its reactivity and solubility properties. This compound typically exhibits moderate polarity due to the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The pyridine moiety contributes to its aromatic character, potentially affecting its electronic properties and interactions with biological systems. As a derivative of pyridine, it may exhibit biological activity, making it of interest in pharmaceutical research. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, its unique functional groups may allow for further chemical modifications, expanding its utility in various synthetic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₉H₁₀FNO₂

InChI: InChI=1S/C9H10FNO2/c10-7-4-5-11-8(6-7)2-1-3-9(12)13/h4-6H,1-3H2,(H,12,13)

InChI key: InChIKey=MCBGGYSPVBLYEC-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)C1=CC(F)=CC=N1

Synonyms:

• 4-Fluoro-2-pyridinebutanoic acid
• 2-Pyridinebutanoic acid, 4-fluoro-