CAS 110099-94-0

2-(methylsulfanyl)pyrimidine-5-carboxylic acid

Description:

2-(Methylsulfanyl)pyrimidine-5-carboxylic acid, with the CAS number 110099-94-0, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a methylsulfanyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to pyrimidine derivatives, such as moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The methylsulfanyl group contributes to its unique reactivity and potential biological activity, as sulfur-containing compounds often play significant roles in medicinal chemistry. The presence of both the methylsulfanyl and carboxylic acid functionalities suggests that this compound may participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Additionally, its structural features may confer specific pharmacological properties, making it of interest in drug development and research. Overall, 2-(methylsulfanyl)pyrimidine-5-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₆H₆N₂O₂S

InChI: InChI=1/C6H6N2O2S/c1-11-6-7-2-4(3-8-6)5(9)10/h2-3H,1H3,(H,9,10)

SMILES: CSc1ncc(cn1)C(=O)O

Synonyms:

• 2-(Methylthio)Pyrimidine-5-Carboxylic Acid
• 5-Pyrimidinecarboxylic Acid, 2-(Methylthio)-

2-(methylthio)-5-pyrimidinecarboxylic acid

CAS: 110099-94-0

Formula: C₆H₆N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.1890

Ref: IN-DA007E1G

2-(Methylthio)pyrimidine-5-carboxylic acid

CAS: 110099-94-0

2-(Methylthio)pyrimidine-5-carboxylic acid

Purity: 98%

Molecular weight: 170.19g/mol

Ref: 54-OR91179

2-(Methylthio)pyrimidine-5-carboxylic acid

CAS: 110099-94-0

Formula: C₆H₆N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.19

Ref: 10-F076798