CAS 1101-41-3
:Tetraphenyldiphosphine
Description:
Tetraphenyldiphosphine, with the CAS number 1101-41-3, is an organophosphorus compound characterized by its unique structure, which features two phosphorus atoms bonded together, each attached to two phenyl groups. This compound is typically a colorless to pale yellow solid at room temperature and is known for its stability and low volatility. Tetraphenyldiphosphine exhibits interesting chemical properties, including the ability to act as a ligand in coordination chemistry, forming complexes with various metals. Its phosphorus-phosphorus bond can participate in redox reactions, making it a subject of interest in synthetic and organometallic chemistry. Additionally, it has applications in the development of phosphine ligands for catalysis and in the synthesis of other phosphorus-containing compounds. Due to its aromatic phenyl groups, tetraphenyldiphosphine also displays significant hydrophobic characteristics, influencing its solubility in organic solvents. Safety precautions should be taken when handling this compound, as with many organophosphorus compounds, due to potential toxicity and reactivity.
Formula:C24H20P2
InChI:InChI=1S/C24H20P2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H
InChI key:InChIKey=DAPZRBJQPPDZGH-UHFFFAOYSA-N
SMILES:P(P(C1=CC=CC=C1)C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- Tetraphenylbiphosphine
- 1,1,2,2-Tetraphenyldiphosphine
- Diphosphine, 1,1,2,2-tetraphenyl-
- Diphosphine, tetraphenyl-
- Tetraphenyldiphosphine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
