CAS 110100-00-0

Ethanone, 1-(2-chloro-5-pyrimidinyl)- (9CI)

Description:

Ethanone, 1-(2-chloro-5-pyrimidinyl)-, also known by its CAS number 110100-00-0, is a chemical compound characterized by its pyrimidine ring structure, which includes a chlorine substituent at the 2-position. This compound is typically classified as a ketone due to the presence of the ethanone functional group. It exhibits properties common to both aromatic and heterocyclic compounds, which may influence its reactivity and interactions with other substances. The presence of the chlorine atom can enhance its electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the pyrimidine moiety may impart biological activity, making this compound of interest in pharmaceutical research. Its solubility, stability, and specific reactivity can vary depending on the solvent and conditions used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₅ClN₂O

InChI: InChI=1/C6H5ClN2O/c1-4(10)5-2-8-6(7)9-3-5/h2-3H,1H3

SMILES: CC(=O)c1cnc(Cl)nc1

Ethanone, 1-(2-chloro-5-pyrimidinyl)- (9CI)

CAS: 110100-00-0

Formula: C₆H₅ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 156.5697

Ref: IN-DA008UD1

1-(2-Chloropyrimidin-5-yl)ethanone

CAS: 110100-00-0

1-(2-Chloropyrimidin-5-yl)ethanone

Purity: 97%

Molecular weight: 156.572g/mol

Ref: 54-OR74620

1-(2-Chloropyrimidin-5-yl)ethanone

CAS: 110100-00-0

Formula: C₆H₅ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 156.57

Ref: 10-F329867