
CAS 1101119-87-2
:5-Methylpyrazolo[1,5-a]pyridine-3-carboxaldehyde
Description:
5-Methylpyrazolo[1,5-a]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures, which contribute to its unique chemical properties. This compound features a methyl group at the 5-position of the pyrazolo ring and an aldehyde functional group at the 3-position of the pyridine ring, making it a versatile building block in organic synthesis. It typically appears as a solid or liquid, depending on the specific conditions, and is soluble in various organic solvents. The presence of the aldehyde group allows for reactivity in condensation reactions and can participate in nucleophilic addition reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure and functional groups suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-7-2-3-11-9(4-7)8(6-12)5-10-11/h2-6H,1H3
InChI key:InChIKey=QSFBWUBWSCZBQI-UHFFFAOYSA-N
SMILES:C(=O)C1=C2N(N=C1)C=CC(C)=C2
Synonyms:- Pyrazolo[1,5-a]pyridine-3-carboxaldehyde, 5-methyl-
- 5-Methylpyrazolo[1,5-a]pyridine-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.