CymitQuimica logo

CAS 1101120-03-9

:

Pyrazolo[1,5-a]pyridine-5-carboxamide

Description:
Pyrazolo[1,5-a]pyridine-5-carboxamide is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes both a pyrazole and a pyridine ring. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. It is often utilized in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various diseases. The presence of the carboxamide functional group enhances its ability to form hydrogen bonds, which can influence its interaction with biological targets. Additionally, the compound may exhibit diverse reactivity patterns, making it a valuable intermediate in synthetic organic chemistry. Its molecular structure allows for potential modifications that can lead to derivatives with enhanced pharmacological properties. Overall, Pyrazolo[1,5-a]pyridine-5-carboxamide represents a significant class of compounds in drug discovery and development, with ongoing research exploring its applications in various therapeutic areas.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-8(12)6-2-4-11-7(5-6)1-3-10-11/h1-5H,(H2,9,12)
InChI key:InChIKey=XCDRZFXDJGFXBD-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC=2N(C=C1)N=CC2
Synonyms:
  • Pyrazolo[1,5-a]pyridine-5-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.