CAS 1101120-09-5

Methyl 3-formylpyrazolo[1,5-a]pyridine-5-carboxylate

Description:

Methyl 3-formylpyrazolo[1,5-a]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a formyl group (-CHO) and a carboxylate ester group (-COOCH3), which contribute to its reactivity and potential applications in organic synthesis. The presence of the pyrazole moiety suggests that it may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for the development of new pharmaceuticals or agrochemicals. The compound is typically synthesized through multi-step reactions involving the appropriate precursors, and its properties can be influenced by factors such as solvent choice and reaction conditions. As with many organic compounds, it is important to handle it with care, considering safety protocols due to potential toxicity or reactivity. Overall, Methyl 3-formylpyrazolo[1,5-a]pyridine-5-carboxylate represents a versatile building block in the field of organic chemistry.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c1-15-10(14)7-2-3-12-9(4-7)8(6-13)5-11-12/h2-6H,1H3

InChI key: InChIKey=SYHVJQWGAHTDMP-UHFFFAOYSA-N

SMILES: C(=O)C1=C2N(N=C1)C=CC(C(OC)=O)=C2

Synonyms:

• Pyrazolo[1,5-a]pyridine-5-carboxylic acid, 3-formyl-, methyl ester
• Methyl 3-formylpyrazolo[1,5-a]pyridine-5-carboxylate