CAS 1101167-56-9

4-(1H-pyrazol-4-yl)benzonitrile

Description:

4-(1H-pyrazol-4-yl)benzonitrile, identified by its CAS number 1101167-56-9, is an organic compound characterized by the presence of a pyrazole ring and a benzonitrile moiety. This compound features a pyrazole group, which is a five-membered ring containing two nitrogen atoms, attached to a benzene ring that is further substituted with a nitrile group (-C≡N). The presence of the nitrile group contributes to its polarity and potential reactivity, making it useful in various chemical applications, including as a building block in organic synthesis and medicinal chemistry. The compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 4-(1H-pyrazol-4-yl)benzonitrile is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₀H₇N₃

InChI: InChI=1S/C10H7N3/c11-5-8-1-3-9(4-2-8)10-6-12-13-7-10/h1-4,6-7H,(H,12,13)

SMILES: c1cc(ccc1C#N)c1c[nH]nc1

Benzonitrile, 4-(1H-pyrazol-4-yl)-

CAS: 1101167-56-9

Formula: C₁₀H₇N₃

Color and Shape: Solid

Molecular weight: 169.1827

Ref: IN-DA00HBOG

4-(1H-Pyrazol-4-yl)benzonitrile

CAS: 1101167-56-9

4-(1H-Pyrazol-4-yl)benzonitrile

Purity: 95%

Molecular weight: 169.18g/mol

Ref: 54-OR910287