
CAS 1101199-66-9
:Ethyl 1-(2-chloroacetyl)-3-oxo-2-piperazineacetate
Description:
Ethyl 1-(2-chloroacetyl)-3-oxo-2-piperazineacetate is a chemical compound characterized by its unique structure, which includes a piperazine ring, an ester functional group, and a chloroacetyl moiety. This compound typically exhibits properties associated with both piperazine derivatives and acylated esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloroacetyl group. The piperazine ring contributes to its biological activity, making it of interest in medicinal chemistry. The presence of the carbonyl and ester functionalities suggests potential for further chemical reactivity, including hydrolysis and nucleophilic substitution. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development contexts. Its molecular weight, boiling point, and melting point would depend on the specific conditions and purity of the sample. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity associated with the chloroacetyl group.
Formula:C10H15ClN2O4
InChI:InChI=1S/C10H15ClN2O4/c1-2-17-9(15)5-7-10(16)12-3-4-13(7)8(14)6-11/h7H,2-6H2,1H3,(H,12,16)
InChI key:InChIKey=RSLPGWDVPNKNMZ-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1N(C(CCl)=O)CCNC1=O
Synonyms:- Ethyl 1-(2-chloroacetyl)-3-oxo-2-piperazineacetate
- 2-Piperazineacetic acid, 1-(2-chloroacetyl)-3-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.