CAS 1101205-23-5: 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)pyridine
Description:2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a trifluoromethyl group and a dioxaborolane moiety. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The dioxaborolane part of the molecule contributes to its potential as a boron-containing compound, which may be relevant in various applications, including organic synthesis and medicinal chemistry. This compound may exhibit properties such as stability under certain conditions, solubility in organic solvents, and potential reactivity in cross-coupling reactions, making it of interest in the development of pharmaceuticals and agrochemicals. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C12H15BF3NO2
InChI:InChI=1S/C12H15BF3NO2/c1-10(2)11(3,4)19-13(18-10)9-6-5-8(7-17-9)12(14,15)16/h5-7H,1-4H3
InChI key:InChIKey=LNTCLMJOCYHWEW-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CN=C(C=C1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)pyridine
- Pyridine, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-TRIFLUOROMETHYLPYRIDINE-2-BORONIC ACID PINACOL ESTER REF: IN-DA008SWNCAS: 1101205-23-5 | 95% | 281.00 €~564.00 € | Wed 02 Apr 25 |
![]() | 5-(Trifluoromethyl)pyridine-2-boronic acid pinacol ester REF: 3D-FT103717CAS: 1101205-23-5 | Min. 95% | - - - | Discontinued product |

5-TRIFLUOROMETHYLPYRIDINE-2-BORONIC ACID PINACOL ESTER
Ref: IN-DA008SWN
10mg | 281.00 € | ||
25mg | 564.00 € |

5-(Trifluoromethyl)pyridine-2-boronic acid pinacol ester
Ref: 3D-FT103717
Undefined size | Discontinued | Request information |