CAS 1101205-24-6: 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Description:2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine is an organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of the 2-methyl group enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The dioxaborolane moiety contributes to its potential as a boron-containing compound, which can be significant in various chemical reactions, particularly in organoboron chemistry. This compound may exhibit unique properties such as enhanced stability, reactivity in cross-coupling reactions, and potential applications in medicinal chemistry or materials science. Its structure suggests that it could participate in various chemical transformations, making it a valuable intermediate in synthetic organic chemistry. Additionally, the presence of the boron atom may impart specific characteristics such as Lewis acidity, which can be exploited in catalysis or as a building block for more complex molecules. Overall, this compound represents a versatile structure with potential applications in diverse fields.
Formula:C11H17BN2O2
InChI:InChI=1S/C11H17BN2O2/c1-8-6-14-9(7-13-8)12-15-10(2,3)11(4,5)16-12/h6-7H,1-5H3
InChI key:InChIKey=OCSJKXYKWMVZNJ-UHFFFAOYSA-N
SMILES:N=1C=C(N=CC1B2OC(C)(C)C(O2)(C)C)C
- Synonyms:
- 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
- Pyrazine, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-Methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-METHYLPYRAZINE-2-BORONIC ACID PINACOL ESTER REF: IN-DA008TY0CAS: 1101205-24-6 | - - - | To inquire | Tue 04 Mar 25 |
![]() | 5-Methylpyrazine-2-boronic acid, pinacol ester REF: 54-OR40073CAS: 1101205-24-6 | - - - | To inquire | Mon 03 Mar 25 |
![]() | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine REF: 10-F766166CAS: 1101205-24-6 | 98% | - - - | Discontinued product |
![]() | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine REF: 3D-FM181778CAS: 1101205-24-6 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
5-METHYLPYRAZINE-2-BORONIC ACID PINACOL ESTER
Ref: IN-DA008TY0
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 54-OR40073
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Ref: 10-F766166
1g | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Ref: 3D-FM181778
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |