CymitQuimica logo

CAS 1101205-24-6

:

2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine

Description:
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine is an organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of the 2-methyl group enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The dioxaborolane moiety contributes to its potential as a boron-containing compound, which can be significant in various chemical reactions, particularly in organoboron chemistry. This compound may exhibit unique properties such as enhanced stability, reactivity in cross-coupling reactions, and potential applications in medicinal chemistry or materials science. Its structure suggests that it could participate in various chemical transformations, making it a valuable intermediate in synthetic organic chemistry. Additionally, the presence of the boron atom may impart specific characteristics such as Lewis acidity, which can be exploited in catalysis or as a building block for more complex molecules. Overall, this compound represents a versatile structure with potential applications in diverse fields.
Formula:C11H17BN2O2
InChI:InChI=1S/C11H17BN2O2/c1-8-6-14-9(7-13-8)12-15-10(2,3)11(4,5)16-12/h6-7H,1-5H3
InChI key:InChIKey=OCSJKXYKWMVZNJ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(C)=CN2
Synonyms:
  • 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
  • Pyrazine, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-Methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Found 2 products.