CAS 110124-49-7
:lexitropsin
Description:
Lexitropsin is a synthetic compound known for its unique properties and biological activity. It belongs to a class of molecules known as minor groove binders, which interact specifically with the DNA minor groove, influencing gene expression and cellular processes. Lexitropsin is characterized by its ability to form stable complexes with DNA, which can lead to alterations in transcription and replication. This compound has garnered interest in the field of medicinal chemistry due to its potential applications in cancer therapy and as an antimicrobial agent. Its structure typically includes a polyamide backbone, which contributes to its binding affinity and specificity. Additionally, lexitropsin's mechanism of action involves the recognition of specific DNA sequences, making it a valuable tool for studying gene regulation and developing targeted therapeutic strategies. However, like many bioactive compounds, its use may be limited by factors such as toxicity and bioavailability, necessitating further research to optimize its therapeutic potential.
Formula:C20H29N5O4
InChI:InChI=1/C20H29N5O4/c1-5-10-25-13-15(12-16(25)19(27)21-9-6-11-24(3)4)23-20(28)17-7-8-18(29-17)22-14(2)26/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,21,27)(H,22,26)(H,23,28)
Synonyms:- 4-({[5-(acetylamino)furan-2-yl]carbonyl}amino)-N-[3-(dimethylamino)propyl]-1-propyl-1H-pyrrole-2-carboxamide
- 4-(((5-(Acetylamino)-2-furanyl)carbonyl)amino)-N-(3-(dimethylamino)propyl)-1-propyl-1H-pyrrole-2-carboxamide
- Lexitropsin
- 1H-Pyrrole-2-carboxamide, 4-(((5-(acetylamino)-2-furanyl)carbonyl)amino)-N-(3-(dimethylamino)propyl)-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lexitropsin
CAS:<p>Lexitropsin is a novel anticancer drug.</p>Formula:C20H29N5O4Color and Shape:SolidMolecular weight:403.48
