CAS 110127-07-6
:2,6-Dibromo-4-nitrotoluene
Description:
2,6-Dibromo-4-nitrotoluene is an aromatic compound characterized by the presence of two bromine atoms and one nitro group attached to a toluene backbone. Its molecular structure features a methyl group (–CH3) and functional groups that significantly influence its chemical properties. The compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. It is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of bromine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The nitro group introduces additional polarity and can affect the compound's reactivity and stability. 2,6-Dibromo-4-nitrotoluene is utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C7H5Br2NO2
InChI:InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3
SMILES:Cc1c(cc(cc1Br)N(=O)=O)Br
Synonyms:- 1,3-Dibromo-2-Methyl-5-Nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Dibromo-4-nitrotoluene, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H5Br2NO2Purity:95%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powder or fused/lumpy solidMolecular weight:294.941,3-Dibromo-2-methyl-4-nitrobenzene
CAS:Formula:C7H5Br2NO2Purity:95%Color and Shape:SolidMolecular weight:294.9281


