CymitQuimica logo

CAS 110139-62-3

:

7-fluoroquinoline-2,3-dicarboxylic acid

Description:
7-Fluoroquinoline-2,3-dicarboxylic acid is a chemical compound that belongs to the class of quinoline derivatives, characterized by a fluorine atom and two carboxylic acid groups attached to the quinoline ring system. This compound typically exhibits a pale yellow to off-white crystalline appearance. The presence of the fluorine atom can influence its biological activity and solubility, while the dicarboxylic acid functionality contributes to its acidity and potential reactivity in various chemical reactions. It is often studied for its potential applications in pharmaceuticals, particularly as an antibacterial or antiviral agent, due to the biological significance of quinoline derivatives. The compound's structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, which is crucial for its application in drug formulation and development. As with many chemical substances, safety data and handling precautions should be observed when working with this compound.
Formula:C11H6FNO4
InChI:InChI=1/C11H6FNO4/c12-6-2-1-5-3-7(10(14)15)9(11(16)17)13-8(5)4-6/h1-4H,(H,14,15)(H,16,17)
SMILES:c1cc(cc2c1cc(c(C(=O)O)n2)C(=O)O)F
Synonyms:
  • 2,3-Quinolinedicarboxylic Acid, 7-Fluoro-
  • 7-Fluoroquinoline-2,3-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.