CAS 110143-05-0
:2′,3′-Dideoxy-2′-fluoroadenosine
Description:
2′,3′-Dideoxy-2′-fluoroadenosine (CAS 110143-05-0) is a synthetic nucleoside analog of adenosine, characterized by the absence of the hydroxyl groups at the 2′ and 3′ positions of the ribose sugar, along with the presence of a fluorine atom at the 2′ position. This modification enhances its stability and resistance to enzymatic degradation, making it a valuable compound in medicinal chemistry, particularly in antiviral and anticancer research. The compound exhibits properties that allow it to interfere with nucleic acid synthesis, which can inhibit the replication of certain viruses and cancer cells. Its mechanism of action typically involves incorporation into RNA or DNA, leading to chain termination during nucleic acid synthesis. Additionally, 2′,3′-dideoxy-2′-fluoroadenosine has been studied for its potential therapeutic applications, including its role as a substrate for various kinases and its effects on cellular metabolism. Overall, its unique structural features contribute to its biological activity and therapeutic potential.
Formula:C10H12FN5O2
InChI:InChI=1S/C10H12FN5O2/c11-6-1-5(2-17)18-10(6)16-4-15-7-8(12)13-3-14-9(7)16/h3-6,10,17H,1-2H2,(H2,12,13,14)/t5-,6+,10+/m0/s1
InChI key:InChIKey=KBEMFSMODRNJHE-BAJZRUMYSA-N
SMILES:F[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](CO)C1
Synonyms:- 2',3'-Dideoxy-2'-fluoroadenosine
- 2′,3′-Dideoxy-2′-fluoroadenosine
- 2′-Fluoro-2′,3′-dideoxyadenosine
- Adenosine, 2',3'-dideoxy-2'-fluoro-
- Adenosine, 2′,3′-dideoxy-2′-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.