CAS 1101668-44-3
:2,5,8,11,14,17,20-Heptaoxatricos-22-yne
Description:
2,5,8,11,14,17,20-Heptaoxatricos-22-yne is a complex organic compound characterized by its unique structure, which includes a long carbon chain interspersed with multiple oxygen atoms. The presence of seven oxygen atoms in its structure suggests that it may exhibit significant polarity, potentially influencing its solubility in various solvents. The compound's name indicates that it contains a series of triple bonds (alkyne functionality), which can impart distinct reactivity patterns, particularly in addition reactions. The arrangement of the carbon and oxygen atoms may also lead to interesting conformational properties and potential applications in materials science or organic synthesis. Additionally, the presence of multiple functional groups could allow for various chemical modifications, making it a versatile compound in synthetic chemistry. However, specific physical properties such as melting point, boiling point, and reactivity would require empirical data for a comprehensive understanding. As with many complex organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H30O7
InChI:InChI=1S/C16H30O7/c1-3-4-18-7-8-20-11-12-22-15-16-23-14-13-21-10-9-19-6-5-17-2/h1H,4-16H2,2H3
InChI key:InChIKey=GBKVTPUSHXYSNK-UHFFFAOYSA-N
SMILES:C(COCCOCCOCC#C)OCCOCCOCCOC
Synonyms:- 2,5,8,11,14,17,20-Heptaoxatricos-22-yne
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
