CAS 110167-16-3
:4-BENZYL-3-CHLOROMETHYL-MORPHOLINE
Description:
4-Benzyl-3-chloromethyl-morpholine is a chemical compound characterized by its morpholine backbone, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a benzyl group and a chloromethyl substituent enhances its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as moderate solubility in organic solvents and may have varying degrees of polarity due to the functional groups attached to the morpholine ring. Its structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are often explored for their biological activity. Additionally, the chloromethyl group can serve as a reactive site for further chemical modifications, making it a versatile intermediate in synthetic pathways. Safety data should be consulted for handling and storage, as compounds with halogen substituents can pose health risks. Overall, 4-benzyl-3-chloromethyl-morpholine is a notable compound in the realm of organic chemistry with implications in various research and industrial applications.
Formula:C12H16ClNO
InChI:InChI=1/C12H16ClNO/c13-8-12-10-15-7-6-14(12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2
SMILES:c1ccc(cc1)CN1CCOCC1CCl
Synonyms:- 3-(Chloromethyl)-4-(phenylmethyl)morpholine
- Morpholine, 3-(chloromethyl)-4-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
