CAS 1101866-03-8
:5,5-Dimethyl-2-(5-methyl-2-furanyl)-1,3,2-dioxaborinane
Description:
5,5-Dimethyl-2-(5-methyl-2-furanyl)-1,3,2-dioxaborinane is an organoboron compound characterized by its unique structural features, including a dioxaborinane ring and a furan substituent. The presence of the dioxaborinane moiety imparts specific reactivity, particularly in the context of boron chemistry, where it can participate in various reactions such as cross-coupling and nucleophilic substitutions. The furan group contributes to the compound's aromatic character, enhancing its stability and potential for electronic interactions. This compound is likely to exhibit moderate solubility in organic solvents due to its relatively non-polar structure, while its boron content may facilitate coordination with other nucleophiles or electrophiles. Additionally, the presence of multiple methyl groups can influence steric hindrance and reactivity, making it a subject of interest in synthetic organic chemistry and materials science. Overall, 5,5-Dimethyl-2-(5-methyl-2-furanyl)-1,3,2-dioxaborinane represents a versatile building block for further chemical transformations and applications in various fields.
Formula:C10H15BO3
InChI:InChI=1S/C10H15BO3/c1-8-4-5-9(14-8)11-12-6-10(2,3)7-13-11/h4-5H,6-7H2,1-3H3
InChI key:InChIKey=ZHDUEHQCGZHEKN-UHFFFAOYSA-N
SMILES:CC=1OC(=CC1)B2OCC(C)(C)CO2
Synonyms:- 5,5-Dimethyl-2-(5-methyl-2-furanyl)-1,3,2-dioxaborinane
- 1,3,2-Dioxaborinane, 5,5-dimethyl-2-(5-methyl-2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
