
CAS 110204-47-2
:Propanoic acid, 2-methyl-, 2-bromopropyl ester
Description:
Propanoic acid, 2-methyl-, 2-bromopropyl ester, also known by its CAS number 110204-47-2, is an organic compound characterized by its ester functional group, which is formed from the reaction of propanoic acid and 2-bromopropanol. This compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. It is expected to have a fruity or sweet odor, common to many esters. The presence of the bromine atom in its structure may impart unique reactivity, particularly in nucleophilic substitution reactions. Additionally, the branched structure of the 2-methyl group can influence its physical properties, such as solubility in various solvents. As with many esters, it may be less soluble in water but more soluble in organic solvents. Safety data should be consulted, as esters can vary in toxicity and environmental impact. Overall, this compound is of interest in organic synthesis and may have applications in the production of fragrances or as intermediates in chemical reactions.
Formula:C7H13BrO2
InChI:InChI=1S/C7H13BrO2/c1-5(2)7(9)10-4-6(3)8/h5-6H,4H2,1-3H3
InChI key:InChIKey=WHQOSPSTIXWNGA-UHFFFAOYSA-N
SMILES:C(OCC(Br)C)(C(C)C)=O
Synonyms:- 2-Bromopropyl isobutyrate
- 2-Bromopropyl 2-methylpropanoate
- Propanoic acid, 2-methyl-, 2-bromopropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.