CAS 110207-44-8
:H-D-Phg-Leu-OH
Description:
H-D-Phg-Leu-OH, also known as a peptide, is a synthetic compound that consists of a phenylglycine (Phg) and leucine (Leu) amino acid sequence. The "H-" prefix indicates that it is in its free acid form, typically used in research and pharmaceutical applications. This compound is characterized by its specific amino acid composition, which contributes to its biological activity and potential applications in drug development. The presence of the phenylglycine residue may enhance its binding properties and stability, while leucine is known for its role in protein synthesis and metabolism. H-D-Phg-Leu-OH is often utilized in studies related to peptide synthesis, structure-activity relationships, and the development of peptide-based therapeutics. Its CAS number, 110207-44-8, uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. As with many peptides, its solubility, stability, and reactivity can vary based on environmental conditions, making it essential to consider these factors in experimental designs.
Formula:C14H20N2O3
InChI:InChI=1/C14H20N2O3/c1-9(2)8-11(14(18)19)16-13(17)12(15)10-6-4-3-5-7-10/h3-7,9,11-12H,8,15H2,1-2H3,(H,16,17)(H,18,19)/t11-,12+/m0/s1
Synonyms:- Aminophenylacetylleucine
- Apal
- alpha-Aminophenylacetyl-leu
- L-Leucine, N-(D-2-phenylglycyl)-
- N-[(2R)-2-amino-2-phenylacetyl]-L-leucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Aminophenylacetylleucine
CAS:Aminophenylacetylleucine is a bioactive chemical.Formula:C14H20N2O3Color and Shape:SolidMolecular weight:264.325H-D-Phg-Leu-OH
CAS:H-D-Phg-Leu-OH is a protein that has been shown to have protease activity. It is encoded by the gene for human mitochondrial protein. H-D-Phg-Leu-OH is involved in the adsorption mechanism of proteins in cells, which may be due to its ability to form disulfide bonds with other molecules. H-D-Phg-Leu-OH also has the ability to bind specifically to antibodies and monoclonal antibodies that are directed against it. The biological function of this protein is not known, but it has been found that it is differentially expressed between women and men. Studies using a polymerase chain reaction showed that H-D-Phg-Leu-OH was upregulated in cancer cells and its expression increased with increasing body mass index (BMI).Formula:C14H20N2O3Purity:Min. 95%Molecular weight:264.32 g/mol

