CAS 110207-93-7
:3-Ethoxy-N,N-dimethylbenzenemethanamine
Description:
3-Ethoxy-N,N-dimethylbenzenemethanamine, identified by its CAS number 110207-93-7, is an organic compound characterized by its amine functional group and an ethoxy substituent. This compound features a benzene ring, which contributes to its aromatic properties, and the presence of the dimethylamino group enhances its basicity and potential for forming hydrogen bonds. The ethoxy group introduces an alkoxy functional group, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit moderate to high polarity due to the presence of both the amine and ethoxy groups, affecting their interactions with solvents and biological systems. Additionally, the structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, given the functional groups that can participate in various chemical reactions. Safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity. Overall, 3-Ethoxy-N,N-dimethylbenzenemethanamine represents a versatile compound within organic chemistry.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-4-13-11-7-5-6-10(8-11)9-12(2)3/h5-8H,4,9H2,1-3H3
SMILES:CCOc1cccc(c1)CN(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.