CAS 11021-14-0: ginsenoside rc
Description:Ginsenoside Rc is a natural compound classified as a triterpenoid saponin, primarily found in ginseng species, particularly Panax ginseng. It is one of the many ginsenosides, which are bioactive constituents believed to contribute to the pharmacological effects of ginseng. Ginsenoside Rc is characterized by its complex structure, featuring a dammarane skeleton with specific glycosylation patterns that influence its biological activity. This compound is known for its potential health benefits, including anti-inflammatory, antioxidant, and neuroprotective properties. Research has indicated that ginsenoside Rc may enhance cognitive function and exhibit cardioprotective effects. Additionally, it has been studied for its role in modulating various signaling pathways, which could be relevant in the context of diseases such as cancer and diabetes. Due to its diverse pharmacological activities, ginsenoside Rc is of significant interest in both traditional medicine and modern pharmacology, although further studies are needed to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C53H90O22
InChI:InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-68-45-41(65)36(60)28(21-56)69-45)24-11-16-52(7)33(24)25(57)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)35(59)27(20-55)71-48)74-46-42(66)38(62)34(58)26(19-54)70-46/h10,24-48,54-67H,9,11-22H2,1-8H3/t24-,25+,26+,27+,28-,29+,30-,31+,32-,33-,34+,35+,36-,37+,38-,39-,40-,41+,42+,43+,44+,45+,46-,47-,48-,50-,51+,52+,53-/m0/s1
InChI key:InChIKey=JDCPEKQWFDWQLI-LUQKBWBOSA-N
SMILES:OCC1OC(OC2C(O)C(O)C(OC2OC3CCC4(C)C(CCC5(C)C4CC(O)C6C(CCC65C)C(OC7OC(COC8OC(CO)C(O)C8O)C(O)C(O)C7O)(C)CCC=C(C)C)C3(C)C)CO)C(O)C(O)C1O
- Synonyms:
- (3β,12β)-20-[(6-O-α-<span class="text-smallcaps">L</smallcap>-Arabinofuranosyl-β-<smallcap>D</smallcap>-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-β-<smallcap>D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranoside
- 12-hydroxy-20-[(6-O-pentofuranosylhexopyranosyl)oxy]dammar-24-en-3-yl 2-O-hexopyranosylhexopyranoside
- Dammarane, β-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- Ginsenoside Rc, Ginsenoside Rb2
- NSC 310104
- Panaxoside Rc
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (3β,12β)-20-[(6-O-α-<smallcap>L</smallcap>-arabinofuranosyl-β-<smallcap>D</smallcap>-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-β-<smallcap>D</span>-glucopyranosyl-