CAS 110221-27-7
:(2R,6R)-6-AMINO-5-OXO-2-(2-THIENYL)PERHYDRO-1,4-THIAZEPINE
Description:
(2R,6R)-6-Amino-5-oxo-2-(2-thienyl)perhydro-1,4-thiazepine is a heterocyclic compound characterized by its unique structural features, including a thiazepine ring, which is a seven-membered ring containing both sulfur and nitrogen atoms. The presence of an amino group and a thienyl substituent contributes to its chemical reactivity and potential biological activity. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its stereochemistry, indicated by the (2R,6R) configuration, suggests specific spatial arrangements that can influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound may be studied for its pharmacological properties, particularly in relation to its potential as a therapeutic agent. Additionally, the thiazepine framework is known for its versatility in drug design, often associated with various biological activities, including antimicrobial and anticonvulsant effects. Overall, this compound represents a significant area of interest for further research and development in pharmaceutical applications.
Formula:C9H12N2OS2
InChI:InChI=1/C9H12N2OS2/c10-6-5-14-8(4-11-9(6)12)7-2-1-3-13-7/h1-3,6,8H,4-5,10H2,(H,11,12)/t6-,8+/m0/s1
Synonyms:- 6-Amino-2-thiophen-2-yl-[1,4]thiazepan-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.