CAS 110223-15-9
:2-AMINOL-3-BENZYLOXYPYRAZINE
Description:
2-Aminol-3-benzyloxypyrazine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of an amino group (-NH2) at the 2-position and a benzyloxy group (-O-CH2-C6H5) at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry or as a pharmacophore in drug design. Additionally, the benzyloxy moiety may influence the compound's lipophilicity and overall biological activity. As with many pyrazine derivatives, 2-aminol-3-benzyloxypyrazine may be of interest in the development of pharmaceuticals, agrochemicals, or other functional materials. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C11H11N3O
InChI:InChI=1/C11H11N3O/c12-10-11(14-7-6-13-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,13)
SMILES:c1ccc(cc1)COc1c(N)nccn1
Synonyms:- 2-Pyrazinamine, 3-(Phenylmethoxy)-
- 3-(Benzyloxy)pyrazin-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Amino-3-benzyloxypyrazine, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H11N3OPurity:96%Molecular weight:201.22
