CAS 110225-00-8
:2-Hexyl-1-dodecanol
Description:
2-Hexyl-1-dodecanol, with the CAS number 110225-00-8, is a long-chain alcohol characterized by its hydrophobic properties due to the presence of a lengthy hydrocarbon chain. This compound features a hexyl group attached to the second carbon of a dodecanol backbone, which contributes to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid at room temperature, exhibiting low volatility and a relatively high boiling point, indicative of its long carbon chain. The presence of the hydroxyl (-OH) functional group imparts some degree of polarity, allowing for limited solubility in water while being more soluble in organic solvents. 2-Hexyl-1-dodecanol is often utilized in various applications, including as a surfactant, emulsifier, or lubricant in industrial formulations. Its structure suggests potential uses in cosmetic and personal care products due to its emollient properties. Additionally, it may exhibit low toxicity, making it suitable for applications where human exposure is a consideration.
Formula:C18H38O
InChI:InChI=1S/C18H38O/c1-3-5-7-9-10-11-12-14-16-18(17-19)15-13-8-6-4-2/h18-19H,3-17H2,1-2H3
InChI key:InChIKey=LOIMOHMWAXGSLR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)(CCCCCC)CO
Synonyms:- 1-Dodecanol, 2-Hexyl-
- 2-Hexyl-1-dodecanol
- 2-Hexyldodecanol
- 2-Hexyldodecyl alcohol
- Eutanol G 16
- 2-Hexyldodecan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hexyl-1-dodecanol
CAS:Controlled ProductFormula:C18H38OColor and Shape:NeatMolecular weight:270.494
