CAS 110225-73-5
:3-pyridin-2-ylcyclohexanone
Description:
3-Pyridin-2-ylcyclohexanone, with the CAS number 110225-73-5, is an organic compound characterized by a cyclohexanone ring substituted with a pyridine group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the pyridine moiety introduces basicity and heterocyclic characteristics, influencing its chemical behavior and interactions. Typically, compounds like 3-pyridin-2-ylcyclohexanone exhibit moderate to high polarity due to the electronegative nitrogen in the pyridine ring, which can affect solubility in various solvents. Additionally, this compound may participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it of interest in medicinal chemistry and material science. Its structural features suggest potential biological activity, although specific pharmacological properties would require further investigation. Overall, 3-pyridin-2-ylcyclohexanone represents a versatile building block in synthetic organic chemistry.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c13-10-5-3-4-9(8-10)11-6-1-2-7-12-11/h1-2,6-7,9H,3-5,8H2
SMILES:c1ccnc(c1)C1CCCC(=O)C1
Synonyms:- 3-(2-pyridyl)cyclohexanone
- Cyclohexanone, 3-(2-pyridinyl)-
- 3-(2-PYRIDINYL)CYCLOHEXANONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.