CAS 110230-97-2

2,2':5',2''-terthiophene-5-carbonitrile

Description:

2,2':5',2''-Terthiophene-5-carbonitrile is an organic compound belonging to the class of thiophenes, which are five-membered aromatic heterocycles containing sulfur. This particular compound features a cyano group (-CN) at the 5-position of the terthiophene structure, which consists of three thiophene rings linked together. The presence of the cyano group enhances its electronic properties, making it useful in various applications, including organic electronics, photovoltaics, and as a building block in organic synthesis. The compound exhibits notable optical properties, often characterized by strong absorption in the UV-visible region, which can be tuned by modifying its structure. Additionally, its conjugated system contributes to its stability and potential for charge transport. The compound is typically synthesized through methods involving the coupling of thiophene derivatives, and its reactivity can be influenced by the electron-withdrawing nature of the cyano group. Overall, 2,2':5',2''-terthiophene-5-carbonitrile is of interest in materials science and organic chemistry due to its unique structural and electronic characteristics.

Formula: C₁₃H₇NS₃

InChI: InChI=1/C13H7NS3/c14-8-9-3-4-12(16-9)13-6-5-11(17-13)10-2-1-7-15-10/h1-7H

SMILES: c1cc(c2ccc(c3ccc(C#N)s3)s2)sc1

Synonyms:

• 2,2':5',2''-Terthiophen-5-carbonitril
• 2,2':5',2"-Terthiophene-5-carbonitrile
• [2,2':5',2''-terthiophene]-5-carbonitrile