CAS 110231-30-6
:diphenyl-1-pyrenylphosphine
Description:
Diphenyl-1-pyrenylphosphine is an organophosphorus compound characterized by the presence of a pyrene moiety, which contributes to its unique photophysical properties. This compound typically exhibits a high degree of stability due to the presence of the phosphorus atom bonded to two phenyl groups and a pyrenyl group. It is known for its potential applications in organic electronics, particularly in light-emitting devices and as a phosphorescent material. The pyrene unit provides strong fluorescence, making it useful in various photonic applications. Additionally, diphenyl-1-pyrenylphosphine can participate in coordination chemistry, forming complexes with transition metals, which may enhance its utility in catalysis and materials science. Its solubility characteristics can vary depending on the solvent, and it is generally considered to be non-volatile and stable under ambient conditions. Safety data should be consulted for handling and storage, as with all chemical substances. Overall, diphenyl-1-pyrenylphosphine is a versatile compound with significant potential in advanced material applications.
Formula:C28H19P
InChI:InChI=1/C28H19P/c1-3-10-23(11-4-1)29(24-12-5-2-6-13-24)26-19-17-22-15-14-20-8-7-9-21-16-18-25(26)28(22)27(20)21/h1-19H
SMILES:c1ccc(cc1)P(c1ccccc1)c1ccc2ccc3cccc4ccc1c2c34
Synonyms:- Diphenyl-Pyren-1-Yl-Phosphane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Diphenyl-1-pyrenylphosphine
CAS:Formula:C28H19PPurity:>95.0%(GC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:386.43diphenyl-1-pyrenylphosphine
CAS:Formula:C28H19PPurity:95%Color and Shape:SolidMolecular weight:386.4242Diphenyl-1-pyrenylphosphine
CAS:DPPP reacts with hydroperoxides, yielding fluorescent DPPP-O for detecting plasma lipid hydroperoxides and LDL oxidation at 351 nm excitation, 380 nm emission.Formula:C28H19PPurity:96.27%Color and Shape:SolidMolecular weight:386.42Diphenyl-1-pyrenylphosphine
CAS:<p>Diphenyl-1-pyrenylphosphine is a fluorescent probe that can be used to detect the presence of reactive oxygen species (ROS) in the cell. It is an analytical method that can be used as a particle, which is a chromatographic method. This technique has been used to study the physiological function of cells and their response to oxidative stress. The expression of wst-1 in these cells was found to be low and linear regression analysis showed an inhibitory effect on protein synthesis by ROS.</p>Formula:C28H19PPurity:Min. 95%Molecular weight:386.42 g/mol






