CAS 110234-44-1

5-(1,1,2,2,2-Pentafluoroethyl)-3-isoxazolamine

Description:

5-(1,1,2,2,2-Pentafluoroethyl)-3-isoxazolamine is a chemical compound characterized by its unique structure, which includes an isoxazole ring and a pentafluoroethyl group. The presence of the pentafluoroethyl moiety imparts significant fluorine content, which can enhance the compound's lipophilicity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The isoxazole ring contributes to the compound's potential biological activity, as heterocycles often play crucial roles in medicinal chemistry. This compound may exhibit specific reactivity patterns due to the electron-withdrawing nature of the fluorinated group, influencing its interaction with biological targets. Additionally, the presence of the amino group in the isoxazole structure can facilitate hydrogen bonding, potentially enhancing its solubility and reactivity in biological systems. Overall, 5-(1,1,2,2,2-Pentafluoroethyl)-3-isoxazolamine represents a class of compounds that combine unique structural features with potential functional properties, making it a subject of interest in chemical research and development.

Formula: C₅H₃F₅N₂O

InChI: InChI=1S/C5H3F5N2O/c6-4(7,5(8,9)10)2-1-3(11)12-13-2/h1H,(H2,11,12)

InChI key: InChIKey=QAZUJNKPFAUCFO-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C1=CC(N)=NO1

Synonyms:

• 3-Isoxazolamine, 5-(1,1,2,2,2-pentafluoroethyl)-
• 3-Isoxazolamine, 5-(pentafluoroethyl)-
• 5-(1,1,2,2,2-Pentafluoroethyl)-3-isoxazolamine