CAS 110241-19-5
:(7β,20ξ)-7,20-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Description:
(7β,20ξ)-7,20-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid, with the CAS number 110241-19-5, is a complex organic compound characterized by its unique tetracyclic structure, which includes multiple hydroxyl groups and a carboxylic acid functional group. This compound belongs to the class of steroid-like molecules, exhibiting a specific stereochemistry that influences its biological activity. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can enhance solubility in polar solvents and may contribute to its reactivity in biochemical pathways. The tetraoxolane moiety indicates the presence of oxygen-rich rings, which can affect the compound's stability and interaction with other molecules. Such compounds often exhibit significant pharmacological properties, making them of interest in medicinal chemistry and drug development. The structural complexity and functional groups present in this molecule may also suggest potential applications in fields such as biochemistry, pharmacology, and materials science, although specific biological activities would require further investigation.
Formula:C30H42O8
InChI:InChI=1S/C30H42O8/c1-15(25(36)37)10-16(31)13-29(6,38)20-12-22(35)30(7)24-17(32)11-19-26(2,3)21(34)8-9-27(19,4)23(24)18(33)14-28(20,30)5/h15,17,19-20,32,38H,8-14H2,1-7H3,(H,36,37)
InChI key:InChIKey=XXHBQOHASACCAP-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(=O)CC4)C(=O)CC1(C)C(C(CC(CC(C(O)=O)C)=O)(C)O)CC2=O
Synonyms:- (7β,20ξ)-7,20-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
- Lanost-8-en-26-oic acid, 7,20-dihydroxy-3,11,15,23-tetraoxo-, (7β,20ξ)-
- Ganoderic acid N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderic acid N
CAS:Ganoderic acid N is a natural terpenoid compound used in biochemical experiments and drug synthesis research.Formula:C30H42O8Purity:99.95%Color and Shape:SolidMolecular weight:530.66Ganoderic acid N
CAS:Controlled ProductGanoderic acid N is a triterpenoid compound, which is a naturally occurring molecule extracted from Ganoderma lucidum, commonly known as Lingzhi or Reishi mushroom. Ganoderma lucidum has been revered in traditional medicine for centuries, particularly in Asian cultures, due to its purported health benefits. The source of ganoderic acid N, Ganoderma lucidum, is a fungus belonging to the Ganodermataceae family, characterized by its distinct reddish, varnished appearance and woody texture.Formula:C30H42O8Purity:Min. 95%Molecular weight:530.6 g/mol



