CAS 110241-23-1
:Lanosta-8,20(22)-dien-26-oic acid, 7,12-dihydroxy-3,11,15,23-tetraoxo-, (7β,12β,20E)-
Description:
Lanosta-8,20(22)-dien-26-oic acid, 7,12-dihydroxy-3,11,15,23-tetraoxo-, (7β,12β,20E)-, is a complex triterpenoid compound characterized by its tetracyclic structure, which is typical of lanostane derivatives. This substance features multiple functional groups, including hydroxyl (-OH) and carbonyl (C=O) groups, contributing to its reactivity and potential biological activity. The presence of these functional groups suggests that it may exhibit various pharmacological properties, including anti-inflammatory and antioxidant activities. The stereochemistry indicated by the (7β,12β,20E) notation highlights the specific spatial arrangement of atoms, which can significantly influence the compound's interactions with biological targets. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry and natural product synthesis. Its CAS number, 110241-23-1, allows for precise identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and biochemistry. Overall, this compound represents a fascinating area of study due to its structural complexity and potential therapeutic implications.
Formula:C30H40O8
InChI:InChI=1S/C30H40O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h10,15,17-19,25,32,36H,8-9,11-13H2,1-7H3,(H,37,38)
InChI key:InChIKey=UFIFFDILGAASQL-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(=O)CC4)C(=O)C(O)C1(C)C(C(=CC(CC(C(O)=O)C)=O)C)CC2=O
Synonyms:- Ganoderenic acid E
- Ganoderenicacid E
- Lanosta-8,20(22)-dien-26-oic acid, 7,12-dihydroxy-3,11,15,23-tetraoxo-, (7β,12β,20E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderenic acid E
CAS:Ganoderenic acid E is a natural productFormula:C30H40O8Purity:98%Color and Shape:SolidMolecular weight:528.642Ganoderenic acid E
CAS:Controlled ProductGanoderenic acid E is a triterpenoid compound, which is a secondary metabolite obtained from the fruiting body of Ganoderma lucidum, commonly known as Reishi mushroom. This compound is part of a broader class of bioactive molecules known for their diverse pharmacological properties. Ganoderenic acid E acts primarily by modulating various signaling pathways associated with oxidative stress, inflammation, and immune response, although the exact molecular mechanisms remain an active area of research.
Formula:C30H40O8Purity:Min. 95%Molecular weight:528.64 g/molRef: 3D-KEA24123
Discontinued product



