CAS 110254-64-3

4-Chloro-3-nitro-1-phenyl-2(1H)-quinolinone

Description:

4-Chloro-3-nitro-1-phenyl-2(1H)-quinolinone is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a quinolinone moiety. This compound features a chloro group and a nitro group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the phenyl group enhances its aromatic character, which can influence its solubility and interaction with biological targets. Typically, compounds of this nature exhibit properties such as moderate to high stability under standard conditions, but their reactivity can vary based on the functional groups present. The nitro group may serve as a site for reduction reactions, while the chloro group can participate in nucleophilic substitution reactions. Such compounds are often investigated for their potential pharmacological activities, including antimicrobial and anticancer properties. Additionally, their synthesis and characterization are of interest in the field of organic chemistry, particularly in the development of new therapeutic agents. Overall, 4-Chloro-3-nitro-1-phenyl-2(1H)-quinolinone represents a valuable structure for further research and application in various chemical and biological contexts.

Formula: C₁₅H₉ClN₂O₃

InChI: InChI=1S/C15H9ClN2O3/c16-13-11-8-4-5-9-12(11)17(10-6-2-1-3-7-10)15(19)14(13)18(20)21/h1-9H

InChI key: InChIKey=XMVBIQDOMQZCFV-UHFFFAOYSA-N

SMILES: O=C1N(C=2C(C(Cl)=C1N(=O)=O)=CC=CC2)C3=CC=CC=C3

Synonyms:

• 4-Chloro-3-nitro-1-phenyl-2(1H)-quinolinone
• 2(1H)-Quinolinone, 4-chloro-3-nitro-1-phenyl-

4-chloro-3-nitro-1-phenyl-1,2-dihydroquinolin-2-one

CAS: 110254-64-3

4-chloro-3-nitro-1-phenyl-1,2-dihydroquinolin-2-one

Purity: ≥95%

Ref: 54-OR26694