CAS 110256-15-0

5-CYCLOPROPYLISOXAZOLE-3-CARBOXYLIC ACI&

Description:

5-Cyclopropylisoxazole-3-carboxylic acid, identified by the CAS number 110256-15-0, is a heterocyclic organic compound featuring a five-membered isoxazole ring with a cyclopropyl substituent and a carboxylic acid functional group. This compound is characterized by its unique structural features, which contribute to its potential biological activity. The isoxazole ring is known for its involvement in various pharmacological properties, while the cyclopropyl group can influence the compound's reactivity and interaction with biological targets. The carboxylic acid group enhances its solubility in polar solvents and can participate in hydrogen bonding, which may affect its pharmacokinetics and bioavailability. Additionally, compounds like this one are often studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature sources for precise values.

Formula: C₇H₇NO₃

InChI: InChI=1/C7H7NO3/c9-7(10)5-3-6(11-8-5)4-1-2-4/h3-4H,1-2H2,(H,9,10)

SMILES: C1CC1c1cc(C(=O)O)no1

Synonyms:

• 3-Isoxazolecarboxylicacid,5-cyclopropyl-(9CI)
• 5-Cyclopropyl-1,2-Oxazole-3-Carboxylic Acid

5-CYCLOPROPYLISOXAZOLE-3-CARBOXYLIC ACID

CAS: 110256-15-0

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA003MPN

5-Cyclopropylisoxazole-3-carboxylic acid

CAS: 110256-15-0

5-Cyclopropylisoxazole-3-carboxylic acid

Purity: 98%

Molecular weight: 153.14g/mol

Ref: 54-OR925637

5-Cyclopropyl-isoxazole-3-carboxylic acid

CAS: 110256-15-0

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F047647