CAS 110287-65-5

rel-(2R,3R)-2-Methyl-3-piperidinecarboxylic acid

Description:

Rel-(2R,3R)-2-Methyl-3-piperidinecarboxylic acid is a chiral compound characterized by its piperidine ring structure, which contributes to its unique stereochemistry. This substance features a carboxylic acid functional group, making it an acidic compound, and the presence of a methyl group at the second carbon enhances its steric properties. The specific stereochemistry, indicated by the (2R,3R) configuration, plays a crucial role in its biological activity and interactions, particularly in pharmaceutical applications. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The compound may exhibit various properties such as melting point, boiling point, and solubility that are influenced by its molecular structure and functional groups. Additionally, its potential applications in medicinal chemistry and as a building block in organic synthesis highlight its importance in research and development. As with many chiral compounds, it may exhibit different behaviors in biological systems depending on its stereochemistry.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c1-5-6(7(9)10)3-2-4-8-5/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/s2

InChI key: InChIKey=LAWPBIIDJCWFFN-IOMOGOHMNA-N

SMILES: C(O)(=O)[C@H]1[C@@H](C)NCCC1

Synonyms:

• rel-(2R,3R)-2-Methyl-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 2-methyl-, cis-
• 3-Piperidinecarboxylic acid, 2-methyl-, (2R,3R)-rel-