CAS 110287-78-0

3-Piperidinecarboxylic acid, 6-methyl-, trans-

Description:

3-Piperidinecarboxylic acid, 6-methyl-, trans- is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group at the 3-position and a methyl group at the 6-position of the piperidine ring. The "trans" designation indicates the specific stereochemistry of the molecule, which affects its spatial arrangement and potentially its biological activity. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the presence of the carboxylic acid group, and they may participate in various chemical reactions, including esterification and amidation. Additionally, the presence of the piperidine moiety suggests potential applications in medicinal chemistry, as piperidine derivatives are often found in pharmaceuticals. The compound's CAS number, 110287-78-0, allows for its identification in chemical databases and literature, facilitating research and development in various fields, including organic synthesis and drug discovery.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c1-5-2-3-6(4-8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/s2

InChI key: InChIKey=ITWDDDADSFZADI-IOMOGOHMNA-N

SMILES: C(O)(=O)[C@H]1CC[C@H](C)NC1

Synonyms:

• 3-Piperidinecarboxylic acid, 6-methyl-, trans-