
CAS 110287-79-1
:3-Piperidinecarboxylic acid, 6-methyl-, cis-
Description:
3-Piperidinecarboxylic acid, 6-methyl-, cis- is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group at the 3-position and a methyl group at the 6-position of the piperidine ring. The "cis" designation indicates that the substituents are on the same side of the ring, which can influence its spatial configuration and reactivity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. It may exhibit biological activity, making it of interest in pharmaceutical research. The presence of the nitrogen atom in the piperidine ring can also contribute to its basicity and potential interactions with biological systems. Overall, 3-Piperidinecarboxylic acid, 6-methyl-, cis- is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-5-2-3-6(4-8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6+/s2
InChI key:InChIKey=ITWDDDADSFZADI-MZQZIECVNA-N
SMILES:C(O)(=O)[C@H]1CC[C@@H](C)NC1
Synonyms:- 3-Piperidinecarboxylic acid, 6-methyl-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
