CAS 110317-48-1
:methyl amino(1H-indol-3-yl)acetate
Description:
Methyl amino(1H-indol-3-yl)acetate, identified by its CAS number 110317-48-1, is a chemical compound that features a methyl group, an amino group, and an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by its potential biological activity, often studied in the context of medicinal chemistry and pharmacology. The presence of the indole moiety suggests that it may exhibit properties similar to those of other indole derivatives, which are known for their roles in various biological processes. Methyl amino(1H-indol-3-yl)acetate may also participate in hydrogen bonding due to its amino group, influencing its solubility and reactivity. Additionally, the acetate group can contribute to the compound's overall polarity and may affect its interaction with biological targets. Overall, this compound's unique structure positions it as a subject of interest for further research in drug development and synthesis.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-15-11(14)10(12)8-6-13-9-5-3-2-4-7(8)9/h2-6,10,13H,12H2,1H3
SMILES:COC(=O)C(c1c[nH]c2ccccc12)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
