CAS 11032-30-7
:(2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside hydrate
Description:
The chemical substance known as (2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside hydrate, with the CAS number 11032-30-7, is a complex glycoside that features a chromenone backbone. This compound exhibits a range of functional groups, including hydroxyl groups and glycosidic linkages, which contribute to its potential biological activity. The presence of the chromenone structure suggests possible antioxidant and anti-inflammatory properties, while the sugar moieties may enhance solubility and bioavailability. As a hydrate, it contains water molecules that can influence its stability and solubility in various solvents. This compound is of interest in the field of natural products and medicinal chemistry, where it may be studied for its pharmacological effects, particularly in relation to its potential therapeutic applications. Its structural complexity and the presence of multiple stereocenters indicate that it may exhibit stereospecific interactions in biological systems.
Formula:C27H34O15
InChI:InChI=1/C27H32O14.H2O/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11;/h2-7,10,16,18,20-30,32-36H,8-9H2,1H3;1H2/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+;/m0./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Naringin dihydrate
CAS:Naringin dihydrate is a flavonoid glycoside, which is a bioactive compound found primarily in citrus fruits, especially grapefruits and oranges. It acts as a potent antioxidant and anti-inflammatory agent, which functions by scavenging free radicals and modulating signaling pathways involved in oxidative stress and inflammation.
Formula:C27H32O14·2H2OPurity:Min. 95%Molecular weight:616.57 g/mol
