CAS 11032-49-8
:Vitamin K2
Description:
Vitamin K2, also known as menaquinone, is a fat-soluble vitamin that plays a crucial role in various physiological processes, particularly in blood coagulation and bone metabolism. It is part of the vitamin K family, which also includes vitamin K1 (phylloquinone). The chemical structure of Vitamin K2 is characterized by a naphthoquinone ring, which is essential for its biological activity, and it features a variable side chain that can differ in length, leading to different forms of menaquinone (e.g., MK-4, MK-7). The CAS number 11032-49-8 specifically refers to one of its forms. Vitamin K2 is primarily found in animal products and fermented foods, such as natto, and is synthesized by gut bacteria in humans. Its absorption is enhanced in the presence of dietary fats, and it is stored in the liver and fatty tissues. Deficiency in Vitamin K2 can lead to increased bleeding tendencies and weakened bone health, highlighting its importance in maintaining overall health.
Formula:Unspecified
InChI:InChI=1/C21H24O2/c1-14(2)8-7-9-15(3)12-13-17-16(4)20(22)18-10-5-6-11-19(18)21(17)23/h5-6,8,10-12H,7,9,13H2,1-4H3/b15-12+
Synonyms:- 2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3-methylnaphthalene-1,4-dione
- Menaquinone
- Menaquinones
- Vitamin K 2
- Vitamin K2 (generic)
- Vitamin K<sub>2</sub>
- Vitamin K2
- MeSH ID: D024482
- Vitamin K2
- Vitamin K2(20)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Vitamin K2
CAS:Vitamin K2 (Menatetrenone) is a menaquinone compound and form of vitamin K2 with potential antineoplastic activity.Formula:C31H40O2Purity:97.56% - 99.53%Color and Shape:White Crystalline PowderMolecular weight:444.65


