CAS 110351-92-3
:20R-Camptothecin
Description:
20R-Camptothecin is a naturally occurring alkaloid derived from the bark of the Camptotheca acuminata tree, known for its potent anticancer properties. It belongs to the class of compounds called camptothecins, which are characterized by their unique pentacyclic structure. The compound exhibits significant inhibition of the enzyme topoisomerase I, which is crucial for DNA replication and transcription, thereby inducing apoptosis in cancer cells. 20R-Camptothecin is known for its low solubility in water, which can pose challenges for formulation in pharmaceutical applications. Its pharmacological profile includes a range of cytotoxic effects against various cancer cell lines, making it a subject of interest in cancer research. However, its clinical use is limited due to toxicity and side effects, prompting ongoing studies to develop more effective derivatives and delivery methods. Overall, 20R-Camptothecin represents a valuable compound in the field of medicinal chemistry, particularly in the development of targeted cancer therapies.
Formula:C20H16N2O4
InChI:InChI=1/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3/t20-/m1/s1
SMILES:CC[C@]1(c2cc3c4c(cc5ccccc5n4)Cn3c(=O)c2COC1=O)O
Synonyms:- (R)-(-)-Camptothecin
- (R)-(-)-Camptothecine
- (R)-4-Ethyl-4-hydroxy-1H-pyrano[3’,4’:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
- (4R)-4-ethyl-4-hydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R)-(-)-Camptothecin
CAS:Controlled ProductFormula:C20H16N2O4Color and Shape:NeatMolecular weight:348.35

