CAS 1103529-64-1

α-[(2-Thienylsulfonyl)amino]benzeneacetic acid

Description:

α-[(2-Thienylsulfonyl)amino]benzeneacetic acid is a chemical compound characterized by its unique structure, which includes a thienyl group and a sulfonamide functional group attached to a benzeneacetic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the thienyl group may impart specific electronic and steric effects, influencing its reactivity and interactions with biological targets. The sulfonamide functionality is known for its role in medicinal chemistry, often enhancing solubility and bioavailability. Additionally, the carboxylic acid group in the benzeneacetic acid structure can participate in hydrogen bonding and ionic interactions, which are crucial for its pharmacological properties. Overall, this compound may exhibit interesting pharmacological activities, making it a subject of interest in drug development and research. However, specific applications and biological effects would require further investigation through empirical studies.

Formula: C₁₂H₁₁NO₄S₂

InChI: InChI=1S/C12H11NO4S2/c14-12(15)11(9-5-2-1-3-6-9)13-19(16,17)10-7-4-8-18-10/h1-8,11,13H,(H,14,15)

InChI key: InChIKey=MQRAXDIFYJBZCA-UHFFFAOYSA-N

SMILES: C(NS(=O)(=O)C1=CC=CS1)(C(O)=O)C2=CC=CC=C2

Synonyms:

• α-[(2-Thienylsulfonyl)amino]benzeneacetic acid
• 2-Phenyl-2-(thiophen-2-ylsulfonylamino)acetic acid
• Benzeneacetic acid, α-[(2-thienylsulfonyl)amino]-
• 2-Phenyl-2-(thiophene-2-sulfonamido)acetic acid
• 2-phenyl-2-(thiophen-2-ylsulfonylamino)ethanoic acid
• 2-phenyl-2-(2-thienylsulfonylamino)acetic acid
• phenyl[(thien-2-ylsulfonyl)amino]acetic acid ISO 9001：2015 REACH
• phenyl[(thien-2-ylsulfonyl)amino]acetic acid