CAS 110356-08-6

2-AMINOPROPYL-5(6)-CARBOXY-BENZIMIDAZOLE

Description:

2-Aminopropyl-5(6)-carboxy-benzimidazole is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an amino group (-NH2) and a propyl group attached to the benzimidazole, as well as a carboxylic acid group (-COOH) at the 5 or 6 position of the ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the carboxylic acid and amino groups. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and biological properties. As with many benzimidazole derivatives, it may have applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₅Cl₂N₃O₂

InChI: InChI=1/C11H13N3O2.2ClH/c12-5-1-2-10-13-8-4-3-7(11(15)16)6-9(8)14-10;;/h3-4,6H,1-2,5,12H2,(H,13,14)(H,15,16);2*1H

Synonyms:

• 1H-benzimidazole-5-carboxylic acid, 2-(3-aminopropyl)-, hydrochloride (1:2)
• 2-(3-Aminopropyl)-1H-benzimidazole-5-carboxylic acid dihydrochloride
• 2-Aminopropyl-5(6)-carboxy-benzimidazole