CAS 110361-77-8

Benzoic acid, 2,3,5-trimethoxy-, methyl ester

Description:

Benzoic acid, 2,3,5-trimethoxy-, methyl ester, identified by the CAS number 110361-77-8, is an organic compound characterized by its ester functional group and a benzoic acid backbone. This compound features three methoxy groups (-OCH3) attached to the benzene ring at the 2, 3, and 5 positions, which significantly influence its chemical properties and reactivity. The presence of these methoxy groups enhances the compound's solubility in organic solvents and may also affect its biological activity. Typically, esters like this one exhibit a pleasant aroma and are often used in flavoring and fragrance applications. In terms of stability, benzoic acid derivatives are generally resistant to hydrolysis under neutral conditions but can be susceptible to hydrolysis in the presence of strong acids or bases. Additionally, the compound may exhibit various interactions in biological systems, making it of interest in pharmacological studies. Overall, its unique structure and functional groups contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₄O₅

InChI: InChI=1S/C11H14O5/c1-13-7-5-8(11(12)16-4)10(15-3)9(6-7)14-2/h5-6H,1-4H3

InChI key: InChIKey=RPUPNUZGTZGLRS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC)C(OC)=CC(OC)=C1

Synonyms:

• Benzoic acid, 2,3,5-trimethoxy-, methyl ester
• Methyl 2,3,5-trimethoxybenzoate