CymitQuimica logo

CAS 1103722-92-4

:

B-[5-[(E)-[4-Oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]-2-thienyl]boronic acid

Description:
B-[5-[(E)-[4-Oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]-2-thienyl]boronic acid is a boronic acid derivative characterized by its unique structural features, including a thienyl group and a thiazolidinylidene moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the thiazolidinylidene and thienyl groups may impart additional biological activity, potentially influencing its reactivity and interaction with biological targets. The compound's boronic acid functionality suggests it may play a role in drug design, particularly in the development of inhibitors for enzymes that utilize diols. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and solvent polarity. Overall, this compound represents a complex structure with potential applications in both synthetic and pharmaceutical chemistry.
Formula:C11H10BNO3S3
InChI:InChI=1S/C11H10BNO3S3/c1-2-5-13-10(14)8(19-11(13)17)6-7-3-4-9(18-7)12(15)16/h2-4,6,15-16H,1,5H2/b8-6+
InChI key:InChIKey=GMGOGGXHSYGCAK-SOFGYWHQSA-N
SMILES:C(=C/1\C(=O)N(CC=C)C(=S)S1)\C=2SC(B(O)O)=CC2
Synonyms:
  • Boronic acid, B-[5-[(E)-[4-oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]-2-thienyl]-
  • B-[5-[(E)-[4-Oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]-2-thienyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.