CymitQuimica logo

CAS 1103738-26-6

:

(5-Iodo-2-chlorophenyl)(4-ethoxyphenyl)methanone

Description:
(5-Iodo-2-chlorophenyl)(4-ethoxyphenyl)methanone, identified by its CAS number 1103738-26-6, is an organic compound characterized by its complex structure featuring both halogen and ether functional groups. This compound contains a phenyl ring substituted with an iodine atom and a chlorine atom, which can influence its reactivity and biological activity. The presence of the ethoxy group on the other phenyl ring enhances its lipophilicity, potentially affecting its solubility in organic solvents and its interaction with biological systems. The methanone functional group indicates that it is a ketone, which may participate in various chemical reactions, such as nucleophilic additions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature for detailed analysis.
Formula:C15H12ClIO2
InChI:InChI=1S/C15H12ClIO2/c1-2-19-12-6-3-10(4-7-12)15(18)13-9-11(17)5-8-14(13)16/h3-9H,2H2,1H3
InChI key:BGRJXWMKCUZBIG-UHFFFAOYSA-N
SMILES:CCOC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)I)Cl
Synonyms:
  • (2-Chloro-5-Iodophenyl)(4-Ethoxyphenyl)Methanone
Found 6 products.