CymitQuimica logo

CAS 1103738-29-9

:

1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodo-Benzene

Description:
1-Chloro-2-[(4-ethoxyphenyl)methyl]-4-iodo-benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both chlorine and iodine atoms, as well as an ethoxyphenylmethyl group. The presence of the chlorine and iodine substituents contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The ethoxy group enhances the compound's solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature and the presence of the ethoxy group, which can affect its interaction with biological membranes. Additionally, the halogen substituents can impart unique electronic properties, making it of interest in medicinal chemistry and materials science. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. Overall, this compound's unique structure positions it as a candidate for further research in synthetic and applied chemistry.
Formula:C15H14ClIO
InChI:InChI=1S/C15H14ClIO/c1-2-18-14-6-3-11(4-7-14)9-12-10-13(17)5-8-15(12)16/h3-8,10H,2,9H2,1H3
InChI key:CZFRIPGHKLGMEU-UHFFFAOYSA-N
SMILES:CCOc1ccc(cc1)Cc1cc(ccc1Cl)I
Synonyms:
  • Benzene, 1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodo-
  • 1-Chloro-2-(4-Ethoxybenzyl)-4-Iodobenzene
  • 4-(5-Iodo-2-chlorobenzyl)phenyl ethyl ether
  • 4-Iodo-1-chloro-2-(4-ethoxybenzyl)benzene
Found 7 products.