CAS 1103827-00-4

2-[3-(4-Fluorophenyl)-1H-pyrazol-4-yl]-4-thiazolidinecarboxylic acid

Description:

2-[3-(4-Fluorophenyl)-1H-pyrazol-4-yl]-4-thiazolidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazolidine ring and a pyrazole moiety substituted with a fluorophenyl group. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the fluorine atom can enhance lipophilicity and alter the electronic properties of the molecule, potentially impacting its interaction with biological targets. Additionally, the thiazolidine ring contributes to the compound's overall stability and may play a role in its pharmacological profile. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry, where modifications to the core structure can lead to variations in efficacy and selectivity. Overall, the characteristics of this compound suggest it may be of interest in drug development and related research areas.

Formula: C₁₃H₁₂FN₃O₂S

InChI: InChI=1S/C13H12FN3O2S/c14-8-3-1-7(2-4-8)11-9(5-15-17-11)12-16-10(6-20-12)13(18)19/h1-5,10,12,16H,6H2,(H,15,17)(H,18,19)

InChI key: InChIKey=ZBMFNZYBCQOJMY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(C=2C(=NNC2)C3=CC=C(F)C=C3)SC1

Synonyms:

• 2-[3-(4-Fluorophenyl)-1H-pyrazol-4-yl]-4-thiazolidinecarboxylic acid
• 4-Thiazolidinecarboxylic acid, 2-[3-(4-fluorophenyl)-1H-pyrazol-4-yl]-