CymitQuimica logo

CAS 1103976-76-6

:

2-Chloro-α-(dimethylamino)-6-fluorobenzeneacetic acid

Description:
2-Chloro-α-(dimethylamino)-6-fluorobenzeneacetic acid is a chemical compound characterized by its unique structural features, including a chloro group, a dimethylamino group, and a fluorine atom attached to a benzene ring. This compound belongs to the class of aromatic carboxylic acids, which typically exhibit acidic properties due to the presence of the carboxyl functional group (-COOH). The presence of the dimethylamino group suggests potential basicity, which can influence its reactivity and solubility in various solvents. The fluorine atom can enhance the compound's lipophilicity and may affect its biological activity. Additionally, the chloro substituent can introduce steric effects that may alter the compound's interaction with biological targets. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmacology, particularly in the development of pharmaceuticals where modifications to aromatic systems can lead to improved efficacy and selectivity. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C10H11ClFNO2
InChI:InChI=1S/C10H11ClFNO2/c1-13(2)9(10(14)15)8-6(11)4-3-5-7(8)12/h3-5,9H,1-2H3,(H,14,15)
InChI key:InChIKey=SZFVVORRSYZEMM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=C(Cl)C=CC=C1F
Synonyms:
  • Benzeneacetic acid, 2-chloro-α-(dimethylamino)-6-fluoro-
  • 2-Chloro-α-(dimethylamino)-6-fluorobenzeneacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.