CymitQuimica logo

CAS 1103976-84-6

:

α-(Dimethylamino)-3,4-dimethoxybenzeneacetic acid

Description:
α-(Dimethylamino)-3,4-dimethoxybenzeneacetic acid, identified by its CAS number 1103976-84-6, is a chemical compound that features a benzene ring substituted with two methoxy groups and a dimethylamino group, along with an acetic acid moiety. This compound is characterized by its potential biological activity, often studied for its role in medicinal chemistry and pharmacology. The presence of the dimethylamino group suggests basic properties, which may influence its solubility and interaction with biological systems. The methoxy groups can enhance lipophilicity and may also participate in various chemical reactions. The compound's structure indicates it could exhibit various functional properties, such as acting as a ligand or influencing neurotransmitter systems. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be of interest in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H17NO4
InChI:InChI=1S/C12H17NO4/c1-13(2)11(12(14)15)8-5-6-9(16-3)10(7-8)17-4/h5-7,11H,1-4H3,(H,14,15)
InChI key:InChIKey=NGKBVRVWMZTRRA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=CC(OC)=C(OC)C=C1
Synonyms:
  • α-(Dimethylamino)-3,4-dimethoxybenzeneacetic acid
  • Benzeneacetic acid, α-(dimethylamino)-3,4-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.